C15H24O10 — CID 130381458
4-[2-hydroxy-3-[(3R)-3-[(3R)-3-hydroxybutanoyl]oxybutanoyl]oxypropoxy]-4-oxobutanoic acid (PubChem CID 130381458) has the molecular formula C15H24O10 and a molecular weight of 364.35 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(3R)-3-[(3R)-3-hydroxybutanoyl]oxybutanoyl]oxypropoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-hydroxy-3-[(3R)-3-[(3R)-3-hydroxybutanoyl]oxybutanoyl]oxypropoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130381458 |
| Molecular Formula | C15H24O10 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 4-[2-hydroxy-3-[(3R)-3-[(3R)-3-hydroxybutanoyl]oxybutanoyl]oxypropoxy]-4-oxobutanoic acid |
| SMILES | C[C@H](CC(=O)OCC(O)COC(=O)CCC(=O)O)OC(=O)C[C@@H](C)O |
| InChI | InChI=1S/C15H24O10/c1-9(16)5-15(22)25-10(2)6-14(21)24-8-11(17)7-23-13(20)4-3-12(18)19/h9-11,16-17H,3-8H2,1-2H3,(H,18,19)/t9-,10-,11?/m1/s1 |
| InChIKey | AZPUIMKSFWEQAP-DIOIDXFWSA-N |
| XLogP | -0.61 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|