C9H20N2O2 — CID 58730214
(E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine (PubChem CID 58730214) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine.
| Compound Name | (E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 58730214 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | (E,4R)-4,6-dimethoxy-5-N-methylhex-2-ene-1,5-diamine |
| SMILES | CNC(COC)[C@@H](/C=C/CN)OC |
| InChI | InChI=1S/C9H20N2O2/c1-11-8(7-12-2)9(13-3)5-4-6-10/h4-5,8-9,11H,6-7,10H2,1-3H3/b5-4+/t8?,9-/m1/s1 |
| InChIKey | KPSYPBUYMPDSMF-HOLAURBTSA-N |
| XLogP | -0.25 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|