C11H20FNO — CID 145312229
(5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,5-dien-3-amine (PubChem CID 145312229) has the molecular formula C11H20FNO and a molecular weight of 201.28 g/mol. Its IUPAC name is (5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,5-dien-3-amine.
| Compound Name | (5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,5-dien-3-amine |
|---|---|
| PubChem CID | 145312229 |
| Molecular Formula | C11H20FNO |
| Molecular Weight | 201.28 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (5E)-6-fluoro-N-methyl-4-propan-2-yloxyhepta-1,5-dien-3-amine |
| SMILES | C=CC(NC)C(/C=C(\C)F)OC(C)C |
| InChI | InChI=1S/C11H20FNO/c1-6-10(13-5)11(7-9(4)12)14-8(2)3/h6-8,10-11,13H,1H2,2-5H3/b9-7+ |
| InChIKey | GTXATBWJAWAKNU-VQHVLOKHSA-N |
| XLogP | 2.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|