C9H14FNO — CID 145312380
4-fluoro-6-propan-2-yloxycyclohexa-2,4-dien-1-amine (PubChem CID 145312380) has the molecular formula C9H14FNO and a molecular weight of 171.21 g/mol. Its IUPAC name is 4-fluoro-6-propan-2-yloxycyclohexa-2,4-dien-1-amine.
| Compound Name | 4-fluoro-6-propan-2-yloxycyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 145312380 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.21 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 4-fluoro-6-propan-2-yloxycyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)OC1C=C(F)C=CC1N |
| InChI | InChI=1S/C9H14FNO/c1-6(2)12-9-5-7(10)3-4-8(9)11/h3-6,8-9H,11H2,1-2H3 |
| InChIKey | DLIFXHAUFQWNEZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |