C10H13F4NO — CID 87688747
1-[4-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,5-dien-1-yl]ethanamine (PubChem CID 87688747) has the molecular formula C10H13F4NO and a molecular weight of 239.21 g/mol. Its IUPAC name is 1-[4-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,5-dien-1-yl]ethanamine.
| Compound Name | 1-[4-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,5-dien-1-yl]ethanamine |
|---|---|
| PubChem CID | 87688747 |
| Molecular Formula | C10H13F4NO |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-[4-(1,1,2,2-tetrafluoroethoxy)cyclohexa-1,5-dien-1-yl]ethanamine |
| SMILES | CC(N)C1=CCC(OC(F)(F)C(F)F)C=C1 |
| InChI | InChI=1S/C10H13F4NO/c1-6(15)7-2-4-8(5-3-7)16-10(13,14)9(11)12/h2-4,6,8-9H,5,15H2,1H3 |
| InChIKey | XKEYBMWMIQSHNL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|