C8H13NO — CID 91355052
6-methoxy-N-methylcyclohexa-2,4-dien-1-amine (PubChem CID 91355052) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 6-methoxy-N-methylcyclohexa-2,4-dien-1-amine.
| Compound Name | 6-methoxy-N-methylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 91355052 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 6-methoxy-N-methylcyclohexa-2,4-dien-1-amine |
| SMILES | CNC1C=CC=CC1OC |
| InChI | InChI=1S/C8H13NO/c1-9-7-5-3-4-6-8(7)10-2/h3-9H,1-2H3 |
| InChIKey | KNGPKFJNKXDWJJ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |