C14H12N6O3S2 — CID 58730678
N'-[2-(10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-ylsulfanyl)acetyl]furan-2-carbohydrazide (PubChem CID 58730678) has the molecular formula C14H12N6O3S2 and a molecular weight of 376.42 g/mol. Its IUPAC name is N'-[2-(10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-ylsulfanyl)acetyl]furan-2-carbohydrazide.
| Compound Name | N'-[2-(10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-ylsulfanyl)acetyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 58730678 |
| Molecular Formula | C14H12N6O3S2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N'-[2-(10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-2,4,7,11-tetraen-5-ylsulfanyl)acetyl]furan-2-carbohydrazide |
| SMILES | O=C(CSc1nnc2n1C=NC1SC=CC21)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C14H12N6O3S2/c21-10(16-18-12(22)9-2-1-4-23-9)6-25-14-19-17-11-8-3-5-24-13(8)15-7-20(11)14/h1-5,7-8,13H,6H2,(H,16,21)(H,18,22) |
| InChIKey | SGMGQWQCANQBBZ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|