C30H35N3O — CID 58730804
N-methyl-2-[4-[3-methyl-2-(2-phenylmethoxyphenyl)-1H-indol-5-yl]piperidin-1-yl]ethanamine (PubChem CID 58730804) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is N-methyl-2-[4-[3-methyl-2-(2-phenylmethoxyphenyl)-1H-indol-5-yl]piperidin-1-yl]ethanamine.
| Compound Name | N-methyl-2-[4-[3-methyl-2-(2-phenylmethoxyphenyl)-1H-indol-5-yl]piperidin-1-yl]ethanamine |
|---|---|
| PubChem CID | 58730804 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N-methyl-2-[4-[3-methyl-2-(2-phenylmethoxyphenyl)-1H-indol-5-yl]piperidin-1-yl]ethanamine |
| SMILES | CNCCN1CCC(c2ccc3[nH]c(-c4ccccc4OCc4ccccc4)c(C)c3c2)CC1 |
| InChI | InChI=1S/C30H35N3O/c1-22-27-20-25(24-14-17-33(18-15-24)19-16-31-2)12-13-28(27)32-30(22)26-10-6-7-11-29(26)34-21-23-8-4-3-5-9-23/h3-13,20,24,31-32H,14-19,21H2,1-2H3 |
| InChIKey | IBKBOGAROMNJBV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |