About dichlorozirconium;hexane;octane
dichlorozirconium;hexane;octane (PubChem CID 58731078) has the molecular formula C14H28Cl2Zr-4
and a molecular weight of 358.51 g/mol. Its IUPAC name is dichlorozirconium;hexane;octane.
Molecular Properties
| Compound Name | dichlorozirconium;hexane;octane |
| PubChem CID | 58731078 |
| Molecular Formula | C14H28Cl2Zr-4 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | dichlorozirconium;hexane;octane |
| SMILES | Cl[Zr]Cl.[CH2-]CC[CH-]CC.[CH2-]CC[CH-]CCCC |
| InChI | InChI=1S/C8H16.C6H12.2ClH.Zr/c1-3-5-7-8-6-4-2;1-3-5-6-4-2;;;/h7H,1,3-6,8H2,2H3;6H,1,3-5H2,2H3;2*1H;/q2*-2;;;+2/p-2 |
| InChIKey | RJPQASUKMWYTQA-UHFFFAOYSA-L |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium;hexane;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;hexane;octane?
The IUPAC name of dichlorozirconium;hexane;octane (CID 58731078) is dichlorozirconium;hexane;octane.
What is the SMILES notation for dichlorozirconium;hexane;octane?
The canonical SMILES for dichlorozirconium;hexane;octane is Cl[Zr]Cl.[CH2-]CC[CH-]CC.[CH2-]CC[CH-]CCCC.
What is the InChIKey of dichlorozirconium;hexane;octane?
The InChIKey is RJPQASUKMWYTQA-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H16.C6H12.2ClH.Zr/c1-3-5-7-8-6-4-2;1-3-5-6-4-2;;;/h7H,1,3-6,8H2,2H3;6H,1,3-5H2,2H3;2*1H;/q2*-2;;;+2/p-2.
What are the key properties of dichlorozirconium;hexane;octane?
dichlorozirconium;hexane;octane has a molecular weight of 358.51 g/mol, XLogP of 6.59, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;hexane;octane is sourced from PubChem (CID 58731078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).