C15H29NO10 — CID 58731374
N-butyl-2,3,4-trihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide (PubChem CID 58731374) has the molecular formula C15H29NO10 and a molecular weight of 383.39 g/mol. Its IUPAC name is N-butyl-2,3,4-trihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide.
| Compound Name | N-butyl-2,3,4-trihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
|---|---|
| PubChem CID | 58731374 |
| Molecular Formula | C15H29NO10 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-butyl-2,3,4-trihydroxy-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentanamide |
| SMILES | CCCCNC(=O)C(O)C(O)C(O)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C15H29NO10/c1-2-3-4-16-14(24)12(22)9(19)7(18)6-25-15-13(23)11(21)10(20)8(5-17)26-15/h7-13,15,17-23H,2-6H2,1H3,(H,16,24) |
| InChIKey | OKECFZFXNMNWMZ-UHFFFAOYSA-N |
| XLogP | -4.20 |
| TPSA | 189.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|