C11H25N2O6P — CID 58731602
methyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-(methylamino)propanoate (PubChem CID 58731602) has the molecular formula C11H25N2O6P and a molecular weight of 312.30 g/mol. Its IUPAC name is methyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-(methylamino)propanoate.
| Compound Name | methyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 58731602 |
| Molecular Formula | C11H25N2O6P |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | methyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-(methylamino)propanoate |
| SMILES | CNC(COP(=O)(O)OCCCCCCN)C(=O)OC |
| InChI | InChI=1S/C11H25N2O6P/c1-13-10(11(14)17-2)9-19-20(15,16)18-8-6-4-3-5-7-12/h10,13H,3-9,12H2,1-2H3,(H,15,16) |
| InChIKey | HMOORUXGQRSZDR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|