C18H37N2O8P — CID 86761159
tert-butyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 86761159) has the molecular formula C18H37N2O8P and a molecular weight of 440.47 g/mol. Its IUPAC name is tert-butyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 86761159 |
| Molecular Formula | C18H37N2O8P |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | tert-butyl 3-[6-aminohexoxy(hydroxy)phosphoryl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(COP(=O)(O)OCCCCCCN)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H37N2O8P/c1-17(2,3)27-15(21)14(20-16(22)28-18(4,5)6)13-26-29(23,24)25-12-10-8-7-9-11-19/h14H,7-13,19H2,1-6H3,(H,20,22)(H,23,24) |
| InChIKey | ZNAXQYJIFNYRGA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|