C12H24NO8P — CID 154984292
tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phosphonooxypropanoate (PubChem CID 154984292) has the molecular formula C12H24NO8P and a molecular weight of 341.30 g/mol. Its IUPAC name is tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phosphonooxypropanoate.
| Compound Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phosphonooxypropanoate |
|---|---|
| PubChem CID | 154984292 |
| Molecular Formula | C12H24NO8P |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | tert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phosphonooxypropanoate |
| SMILES | CC(C)(C)OC(=O)NC(COP(=O)(O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24NO8P/c1-11(2,3)20-9(14)8(7-19-22(16,17)18)13-10(15)21-12(4,5)6/h8H,7H2,1-6H3,(H,13,15)(H2,16,17,18) |
| InChIKey | CVALMIHITOGVPY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|