About (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite
(3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite (PubChem CID 58731893) has the molecular formula C6H8F4O3
and a molecular weight of 204.12 g/mol. Its IUPAC name is (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite.
Analyze (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite?
The IUPAC name of (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite (CID 58731893) is (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite.
What is the SMILES notation for (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite?
The canonical SMILES for (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite is CCOC(C)(F)C(=O)C(F)(F)OF.
What is the InChIKey of (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite?
The InChIKey is OQMAKTWQTHQRLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F4O3/c1-3-12-5(2,7)4(11)6(8,9)13-10/h3H2,1-2H3.
What are the key properties of (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite?
(3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite has a molecular weight of 204.12 g/mol, XLogP of 1.77, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-1,1,3-trifluoro-2-oxobutyl) hypofluorite is sourced from PubChem (CID 58731893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).