C46H30N18 — CID 58732001
9,10,11,12,21,22,23,24-octa(imidazol-1-yl)-3,6-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene (PubChem CID 58732001) has the molecular formula C46H30N18 and a molecular weight of 834.87 g/mol. Its IUPAC name is 9,10,11,12,21,22,23,24-octa(imidazol-1-yl)-3,6-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene.
| Compound Name | 9,10,11,12,21,22,23,24-octa(imidazol-1-yl)-3,6-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
|---|---|
| PubChem CID | 58732001 |
| Molecular Formula | C46H30N18 |
| Molecular Weight | 834.87 g/mol |
| Exact Mass | 834.29 |
| IUPAC Name | 9,10,11,12,21,22,23,24-octa(imidazol-1-yl)-3,6-diazapentacyclo[18.4.0.02,7.08,13.014,19]tetracosa-1,3,5,7,9,11,13,15,17,19,21,23-dodecaene |
| SMILES | c1ccc2c(c1)=c1c(-n3ccnc3)c(-n3ccnc3)c(-n3ccnc3)c(-n3ccnc3)c1=c1nccnc1=c1c(-n3ccnc3)c(-n3ccnc3)c(-n3ccnc3)c(-n3ccnc3)c1=2 |
| InChI | InChI=1S/C46H30N18/c1-2-4-32-31(3-1)33-35(41(59-17-9-49-25-59)45(63-21-13-53-29-63)43(61-19-11-51-27-61)39(33)57-15-7-47-23-57)37-38(56-6-5-55-37)36-34(32)40(58-16-8-48-24-58)44(62-20-12-52-28-62)46(64-22-14-54-30-64)42(36)60-18-10-50-26-60/h1-30H |
| InChIKey | MNOUFKJDPRKRGU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 168.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.87 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |