C8H17N4O2+ — CID 58732071
2-amino-2-[1-[bis(methylamino)methylidene]azetidin-1-ium-2-yl]acetic acid (PubChem CID 58732071) has the molecular formula C8H17N4O2+ and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-amino-2-[1-[bis(methylamino)methylidene]azetidin-1-ium-2-yl]acetic acid.
| Compound Name | 2-amino-2-[1-[bis(methylamino)methylidene]azetidin-1-ium-2-yl]acetic acid |
|---|---|
| PubChem CID | 58732071 |
| Molecular Formula | C8H17N4O2+ |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2-amino-2-[1-[bis(methylamino)methylidene]azetidin-1-ium-2-yl]acetic acid |
| SMILES | CNC(NC)=[N+]1CCC1C(N)C(=O)O |
| InChI | InChI=1S/C8H16N4O2/c1-10-8(11-2)12-4-3-5(12)6(9)7(13)14/h5-6H,3-4,9H2,1-2H3,(H2,10,11,13,14)/p+1 |
| InChIKey | GAZVDNWHEWSEAU-UHFFFAOYSA-O |
| XLogP | -2.02 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|