C27H25FN4O2 — CID 58735193
5-[4-[8-(2-fluoro-4-isocyanophenyl)quinolin-4-yl]oxycyclohexyl]-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 58735193) has the molecular formula C27H25FN4O2 and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-[4-[8-(2-fluoro-4-isocyanophenyl)quinolin-4-yl]oxycyclohexyl]-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[4-[8-(2-fluoro-4-isocyanophenyl)quinolin-4-yl]oxycyclohexyl]-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 58735193 |
| Molecular Formula | C27H25FN4O2 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 5-[4-[8-(2-fluoro-4-isocyanophenyl)quinolin-4-yl]oxycyclohexyl]-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(OC4CCC(c5nc(C(C)C)no5)CC4)ccnc23)c(F)c1 |
| InChI | InChI=1S/C27H25FN4O2/c1-16(2)26-31-27(34-32-26)17-7-10-19(11-8-17)33-24-13-14-30-25-21(5-4-6-22(24)25)20-12-9-18(29-3)15-23(20)28/h4-6,9,12-17,19H,7-8,10-11H2,1-2H3 |
| InChIKey | SRSHSCPKHAHZJR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|