C20H28N2O — CID 58948339
4-[1-(2,2-dimethylpropyl)piperidin-4-yl]oxy-8-methylquinoline (PubChem CID 58948339) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-[1-(2,2-dimethylpropyl)piperidin-4-yl]oxy-8-methylquinoline.
| Compound Name | 4-[1-(2,2-dimethylpropyl)piperidin-4-yl]oxy-8-methylquinoline |
|---|---|
| PubChem CID | 58948339 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 4-[1-(2,2-dimethylpropyl)piperidin-4-yl]oxy-8-methylquinoline |
| SMILES | Cc1cccc2c(OC3CCN(CC(C)(C)C)CC3)ccnc12 |
| InChI | InChI=1S/C20H28N2O/c1-15-6-5-7-17-18(8-11-21-19(15)17)23-16-9-12-22(13-10-16)14-20(2,3)4/h5-8,11,16H,9-10,12-14H2,1-4H3 |
| InChIKey | PEUFMFHXVFNEQR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |