C9H12N2O — CID 58738750
1,2-dimethyl-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-3-olate (PubChem CID 58738750) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,2-dimethyl-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-3-olate.
| Compound Name | 1,2-dimethyl-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-3-olate |
|---|---|
| PubChem CID | 58738750 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,2-dimethyl-2,3-dihydroimidazo[1,2-a]pyridin-4-ium-3-olate |
| SMILES | CC1C([O-])[n+]2ccccc2N1C |
| InChI | InChI=1S/C9H12N2O/c1-7-9(12)11-6-4-3-5-8(11)10(7)2/h3-7,9H,1-2H3 |
| InChIKey | GOMFMRGYNIGMAX-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|