C23H27N3O4S — CID 58740310
ethyl 4-[4-(butylcarbamoyl)-1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate (PubChem CID 58740310) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is ethyl 4-[4-(butylcarbamoyl)-1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[4-(butylcarbamoyl)-1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 58740310 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | ethyl 4-[4-(butylcarbamoyl)-1-(4-methoxyphenyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate |
| SMILES | CCCCNC(=O)c1cc(-c2csc(C(=O)OCC)n2)n(-c2ccc(OC)cc2)c1C |
| InChI | InChI=1S/C23H27N3O4S/c1-5-7-12-24-21(27)18-13-20(19-14-31-22(25-19)23(28)30-6-2)26(15(18)3)16-8-10-17(29-4)11-9-16/h8-11,13-14H,5-7,12H2,1-4H3,(H,24,27) |
| InChIKey | JDGPQFDWWPXTQJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|