C22H20ClN3O3S — CID 58740433
5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-1-(furan-2-yl)-N-(2-methoxyethyl)-2-methylpyrrole-3-carboxamide (PubChem CID 58740433) has the molecular formula C22H20ClN3O3S and a molecular weight of 441.94 g/mol. Its IUPAC name is 5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-1-(furan-2-yl)-N-(2-methoxyethyl)-2-methylpyrrole-3-carboxamide.
| Compound Name | 5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-1-(furan-2-yl)-N-(2-methoxyethyl)-2-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58740433 |
| Molecular Formula | C22H20ClN3O3S |
| Molecular Weight | 441.94 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 5-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-1-(furan-2-yl)-N-(2-methoxyethyl)-2-methylpyrrole-3-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2csc(-c3ccccc3Cl)n2)n(-c2ccco2)c1C |
| InChI | InChI=1S/C22H20ClN3O3S/c1-14-16(21(27)24-9-11-28-2)12-19(26(14)20-8-5-10-29-20)18-13-30-22(25-18)15-6-3-4-7-17(15)23/h3-8,10,12-13H,9,11H2,1-2H3,(H,24,27) |
| InChIKey | ROPSOYXWPYKUAL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|