C24H26N2O3 — CID 58740877
tert-butyl (E)-3-[4-[[5-(2-methoxyphenyl)-1H-imidazol-2-yl]methyl]phenyl]prop-2-enoate (PubChem CID 58740877) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-[[5-(2-methoxyphenyl)-1H-imidazol-2-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[4-[[5-(2-methoxyphenyl)-1H-imidazol-2-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58740877 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | tert-butyl (E)-3-[4-[[5-(2-methoxyphenyl)-1H-imidazol-2-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COc1ccccc1-c1cnc(Cc2ccc(/C=C/C(=O)OC(C)(C)C)cc2)[nH]1 |
| InChI | InChI=1S/C24H26N2O3/c1-24(2,3)29-23(27)14-13-17-9-11-18(12-10-17)15-22-25-16-20(26-22)19-7-5-6-8-21(19)28-4/h5-14,16H,15H2,1-4H3,(H,25,26)/b14-13+ |
| InChIKey | FMZCHYDUQWFMIL-BUHFOSPRSA-N |
| XLogP | 5.03 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|