C11H19Cl2NO — CID 58741319
N-butyl-2,2-dichloro-1-ethyl-3-methylcyclopropane-1-carboxamide (PubChem CID 58741319) has the molecular formula C11H19Cl2NO and a molecular weight of 252.18 g/mol. Its IUPAC name is N-butyl-2,2-dichloro-1-ethyl-3-methylcyclopropane-1-carboxamide.
| Compound Name | N-butyl-2,2-dichloro-1-ethyl-3-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 58741319 |
| Molecular Formula | C11H19Cl2NO |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N-butyl-2,2-dichloro-1-ethyl-3-methylcyclopropane-1-carboxamide |
| SMILES | CCCCNC(=O)C1(CC)C(C)C1(Cl)Cl |
| InChI | InChI=1S/C11H19Cl2NO/c1-4-6-7-14-9(15)10(5-2)8(3)11(10,12)13/h8H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | RLFCNBHCOWAZDD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|