C28H27FN6O3 — CID 58744632
16-amino-19-(3-aminopyrrolidine-1-carbonyl)-14-(3-aminopyrrolidin-1-yl)-15-fluoro-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaen-18-one (PubChem CID 58744632) has the molecular formula C28H27FN6O3 and a molecular weight of 514.56 g/mol. Its IUPAC name is 16-amino-19-(3-aminopyrrolidine-1-carbonyl)-14-(3-aminopyrrolidin-1-yl)-15-fluoro-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaen-18-one.
| Compound Name | 16-amino-19-(3-aminopyrrolidine-1-carbonyl)-14-(3-aminopyrrolidin-1-yl)-15-fluoro-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaen-18-one |
|---|---|
| PubChem CID | 58744632 |
| Molecular Formula | C28H27FN6O3 |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 16-amino-19-(3-aminopyrrolidine-1-carbonyl)-14-(3-aminopyrrolidin-1-yl)-15-fluoro-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaen-18-one |
| SMILES | Nc1c(F)c(N2CCC(N)C2)c2c3c1c(=O)c(C(=O)N1CCC(N)C1)cn3-c1cc3ccccc3cc1O2 |
| InChI | InChI=1S/C28H27FN6O3/c29-22-23(32)21-24-27(25(22)33-7-5-16(30)11-33)38-20-10-15-4-2-1-3-14(15)9-19(20)35(24)13-18(26(21)36)28(37)34-8-6-17(31)12-34/h1-4,9-10,13,16-17H,5-8,11-12,30-32H2 |
| InChIKey | VFWVBYIRIWKAAU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|