C30H33FN6O3 — CID 58744549
16-amino-14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide (PubChem CID 58744549) has the molecular formula C30H33FN6O3 and a molecular weight of 544.63 g/mol. Its IUPAC name is 16-amino-14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide.
| Compound Name | 16-amino-14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
|---|---|
| PubChem CID | 58744549 |
| Molecular Formula | C30H33FN6O3 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 16-amino-14-(3-aminopyrrolidin-1-yl)-N-[4-(dimethylamino)butyl]-15-fluoro-18-oxo-12-oxa-1-azapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-2,4,6,8,10,13(21),14,16,19-nonaene-19-carboxamide |
| SMILES | CN(C)CCCCNC(=O)c1cn2c3c(c(N4CCC(N)C4)c(F)c(N)c3c1=O)Oc1cc3ccccc3cc1-2 |
| InChI | InChI=1S/C30H33FN6O3/c1-35(2)11-6-5-10-34-30(39)20-16-37-21-13-17-7-3-4-8-18(17)14-22(21)40-29-26(37)23(28(20)38)25(33)24(31)27(29)36-12-9-19(32)15-36/h3-4,7-8,13-14,16,19H,5-6,9-12,15,32-33H2,1-2H3,(H,34,39) |
| InChIKey | JAIXNXMXXZIOPO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|