C16H11N7O — CID 58745811
7-(furan-2-yl)-3-[(3-isocyanophenyl)methyl]triazolo[4,5-d]pyrimidin-5-amine (PubChem CID 58745811) has the molecular formula C16H11N7O and a molecular weight of 317.31 g/mol. Its IUPAC name is 7-(furan-2-yl)-3-[(3-isocyanophenyl)methyl]triazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 7-(furan-2-yl)-3-[(3-isocyanophenyl)methyl]triazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 58745811 |
| Molecular Formula | C16H11N7O |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 7-(furan-2-yl)-3-[(3-isocyanophenyl)methyl]triazolo[4,5-d]pyrimidin-5-amine |
| SMILES | [C-]#[N+]c1cccc(Cn2nnc3c(-c4ccco4)nc(N)nc32)c1 |
| InChI | InChI=1S/C16H11N7O/c1-18-11-5-2-4-10(8-11)9-23-15-14(21-22-23)13(19-16(17)20-15)12-6-3-7-24-12/h2-8H,9H2,(H2,17,19,20) |
| InChIKey | JWZPXEGQFVXBIK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|