C15H11FN6O — CID 141160728
2-fluoro-5-[[7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]aniline (PubChem CID 141160728) has the molecular formula C15H11FN6O and a molecular weight of 310.29 g/mol. Its IUPAC name is 2-fluoro-5-[[7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]aniline.
| Compound Name | 2-fluoro-5-[[7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]aniline |
|---|---|
| PubChem CID | 141160728 |
| Molecular Formula | C15H11FN6O |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-fluoro-5-[[7-(furan-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]aniline |
| SMILES | Nc1cc(Cn2nnc3c(-c4ccco4)ncnc32)ccc1F |
| InChI | InChI=1S/C15H11FN6O/c16-10-4-3-9(6-11(10)17)7-22-15-14(20-21-22)13(18-8-19-15)12-2-1-5-23-12/h1-6,8H,7,17H2 |
| InChIKey | RLAPLRAQUQEDTG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|