C15H9FIN5O — CID 141055886
3-[(2-fluoro-5-iodophenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidine (PubChem CID 141055886) has the molecular formula C15H9FIN5O and a molecular weight of 421.17 g/mol. Its IUPAC name is 3-[(2-fluoro-5-iodophenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidine.
| Compound Name | 3-[(2-fluoro-5-iodophenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 141055886 |
| Molecular Formula | C15H9FIN5O |
| Molecular Weight | 421.17 g/mol |
| Exact Mass | 420.98 |
| IUPAC Name | 3-[(2-fluoro-5-iodophenyl)methyl]-7-(furan-2-yl)triazolo[4,5-d]pyrimidine |
| SMILES | Fc1ccc(I)cc1Cn1nnc2c(-c3ccco3)ncnc21 |
| InChI | InChI=1S/C15H9FIN5O/c16-11-4-3-10(17)6-9(11)7-22-15-14(20-21-22)13(18-8-19-15)12-2-1-5-23-12/h1-6,8H,7H2 |
| InChIKey | FGKUHKKNXGUQBU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|