C21H20ClN3O2S — CID 58748157
5-chloro-N-[[1-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-3-yl]methyl]thiophene-2-carboxamide (PubChem CID 58748157) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 5-chloro-N-[[1-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-3-yl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[1-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-3-yl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 58748157 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 5-chloro-N-[[1-[4-(2-oxo-1-pyridinyl)phenyl]pyrrolidin-3-yl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCN(c2ccc(-n3ccccc3=O)cc2)C1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C21H20ClN3O2S/c22-19-9-8-18(28-19)21(27)23-13-15-10-12-24(14-15)16-4-6-17(7-5-16)25-11-2-1-3-20(25)26/h1-9,11,15H,10,12-14H2,(H,23,27) |
| InChIKey | QCTFQRPZBNQVBC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|