C20H17ClN4O2S — CID 143722963
N-[3-amino-2-[[4-(2-oxo-1-pyridinyl)phenyl]iminomethyl]prop-2-enyl]-5-chlorothiophene-2-carboxamide (PubChem CID 143722963) has the molecular formula C20H17ClN4O2S and a molecular weight of 412.90 g/mol. Its IUPAC name is N-[3-amino-2-[[4-(2-oxo-1-pyridinyl)phenyl]iminomethyl]prop-2-enyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[3-amino-2-[[4-(2-oxo-1-pyridinyl)phenyl]iminomethyl]prop-2-enyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 143722963 |
| Molecular Formula | C20H17ClN4O2S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | N-[3-amino-2-[[4-(2-oxo-1-pyridinyl)phenyl]iminomethyl]prop-2-enyl]-5-chlorothiophene-2-carboxamide |
| SMILES | NC=C(/C=N/c1ccc(-n2ccccc2=O)cc1)CNC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C20H17ClN4O2S/c21-18-9-8-17(28-18)20(27)24-13-14(11-22)12-23-15-4-6-16(7-5-15)25-10-2-1-3-19(25)26/h1-12H,13,22H2,(H,24,27)/b14-11?,23-12+ |
| InChIKey | OGMSXTQUBCSNFK-LHSHSSRMSA-N |
| XLogP | 3.53 |
| TPSA | 89.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|