C31H40N4O4S — CID 58749769
tert-butyl N-[(2S)-2-(3-acetamidophenyl)-2-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]carbamate (PubChem CID 58749769) has the molecular formula C31H40N4O4S and a molecular weight of 564.75 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-(3-acetamidophenyl)-2-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-(3-acetamidophenyl)-2-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 58749769 |
| Molecular Formula | C31H40N4O4S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | tert-butyl N-[(2S)-2-(3-acetamidophenyl)-2-[(6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinoline-2-carbonyl)amino]ethyl]carbamate |
| SMILES | CC(=O)Nc1cccc([C@@H](CNC(=O)OC(C)(C)C)NC(=O)c2cc3cc4c(nc3s2)CCC(C(C)(C)C)C4)c1 |
| InChI | InChI=1S/C31H40N4O4S/c1-18(36)33-23-10-8-9-19(15-23)25(17-32-29(38)39-31(5,6)7)34-27(37)26-16-21-13-20-14-22(30(2,3)4)11-12-24(20)35-28(21)40-26/h8-10,13,15-16,22,25H,11-12,14,17H2,1-7H3,(H,32,38)(H,33,36)(H,34,37)/t22?,25-/m1/s1 |
| InChIKey | DLJJCNDSVMGUCI-NRWPOFLRSA-N |
| XLogP | 6.40 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |