C38H25N5 — CID 58750621
9-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]pyrido[3,4-b]indole (PubChem CID 58750621) has the molecular formula C38H25N5 and a molecular weight of 551.65 g/mol. Its IUPAC name is 9-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]pyrido[3,4-b]indole.
| Compound Name | 9-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 58750621 |
| Molecular Formula | C38H25N5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 9-[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]pyrido[3,4-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(-n5c6ccccc6c6ccncc65)cc4)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C38H25N5/c1-2-10-37-31(7-1)32-19-22-39-25-38(32)43(37)30-17-15-27(16-18-30)26-11-13-28(14-12-26)29-23-35(33-8-3-5-20-40-33)42-36(24-29)34-9-4-6-21-41-34/h1-25H |
| InChIKey | SKRUSIHGDBUREE-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |