C32H21N5 — CID 58750680
9-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]pyrido[3,4-b]indole (PubChem CID 58750680) has the molecular formula C32H21N5 and a molecular weight of 475.56 g/mol. Its IUPAC name is 9-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]pyrido[3,4-b]indole.
| Compound Name | 9-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 58750680 |
| Molecular Formula | C32H21N5 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 9-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]pyrido[3,4-b]indole |
| SMILES | c1ccc(-c2cc(-c3ccc(-n4c5ccccc5c5ccncc54)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C32H21N5/c1-2-10-31-25(7-1)26-15-18-33-21-32(26)37(31)24-13-11-22(12-14-24)23-19-29(27-8-3-5-16-34-27)36-30(20-23)28-9-4-6-17-35-28/h1-21H |
| InChIKey | NVYNDBYTCCEBKM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |