C30H16F4N4 — CID 58750653
9-[2,3,5,6-tetrafluoro-4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]pyrido[3,4-b]indole (PubChem CID 58750653) has the molecular formula C30H16F4N4 and a molecular weight of 508.48 g/mol. Its IUPAC name is 9-[2,3,5,6-tetrafluoro-4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]pyrido[3,4-b]indole.
| Compound Name | 9-[2,3,5,6-tetrafluoro-4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 58750653 |
| Molecular Formula | C30H16F4N4 |
| Molecular Weight | 508.48 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | 9-[2,3,5,6-tetrafluoro-4-(2-phenylimidazo[1,2-a]pyridin-3-yl)phenyl]pyrido[3,4-b]indole |
| SMILES | Fc1c(F)c(-n2c3ccccc3c3ccncc32)c(F)c(F)c1-c1c(-c2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C30H16F4N4/c31-24-23(29-28(17-8-2-1-3-9-17)36-22-12-6-7-15-37(22)29)25(32)27(34)30(26(24)33)38-20-11-5-4-10-18(20)19-13-14-35-16-21(19)38/h1-16H |
| InChIKey | UNBWHCNAKAPEKV-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.48 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|