C16H12BrFN2O3S — CID 58752198
ethyl 2-[2-(bromomethyl)-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1,3-thiazole-4-carboxylate (PubChem CID 58752198) has the molecular formula C16H12BrFN2O3S and a molecular weight of 411.25 g/mol. Its IUPAC name is ethyl 2-[2-(bromomethyl)-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[2-(bromomethyl)-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 58752198 |
| Molecular Formula | C16H12BrFN2O3S |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 409.97 |
| IUPAC Name | ethyl 2-[2-(bromomethyl)-4-(4-fluorophenyl)-1,3-oxazol-5-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2oc(CBr)nc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C16H12BrFN2O3S/c1-2-22-16(21)11-8-24-15(19-11)14-13(20-12(7-17)23-14)9-3-5-10(18)6-4-9/h3-6,8H,2,7H2,1H3 |
| InChIKey | HOQYRYUIEWLPBH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|