C24H14F6IrN3O2- — CID 58756210
iridium;pyridine-2-carboxylic acid;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine (PubChem CID 58756210) has the molecular formula C24H14F6IrN3O2- and a molecular weight of 682.60 g/mol. Its IUPAC name is iridium;pyridine-2-carboxylic acid;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | iridium;pyridine-2-carboxylic acid;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 58756210 |
| Molecular Formula | C24H14F6IrN3O2- |
| Molecular Weight | 682.60 g/mol |
| Exact Mass | 683.06 |
| IUPAC Name | iridium;pyridine-2-carboxylic acid;2-[4-(trifluoromethyl)benzene-6-id-1-yl]-3-[4-(trifluoromethyl)phenyl]pyrazine |
| SMILES | FC(F)(F)c1c[c-]c(-c2nccnc2-c2ccc(C(F)(F)F)cc2)cc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C18H9F6N2.C6H5NO2.Ir/c19-17(20,21)13-5-1-11(2-6-13)15-16(26-10-9-25-15)12-3-7-14(8-4-12)18(22,23)24;8-6(9)5-3-1-2-4-7-5;/h1-3,5-10H;1-4H,(H,8,9);/q-1;; |
| InChIKey | TUHINVYCCZNVBP-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.60 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|