C17H13N2OY- — CID 58756407
8,12-dimethyl-7,11-dihydroindolizino[1,2-b]quinolin-7-id-9-one;yttrium (PubChem CID 58756407) has the molecular formula C17H13N2OY- and a molecular weight of 350.21 g/mol. Its IUPAC name is 8,12-dimethyl-7,11-dihydroindolizino[1,2-b]quinolin-7-id-9-one;yttrium.
| Compound Name | 8,12-dimethyl-7,11-dihydroindolizino[1,2-b]quinolin-7-id-9-one;yttrium |
|---|---|
| PubChem CID | 58756407 |
| Molecular Formula | C17H13N2OY- |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 8,12-dimethyl-7,11-dihydroindolizino[1,2-b]quinolin-7-id-9-one;yttrium |
| SMILES | Cc1[c-]cc2n(c1=O)Cc1c-2nc2ccccc2c1C.[Y] |
| InChI | InChI=1S/C17H13N2O.Y/c1-10-7-8-15-16-13(9-19(15)17(10)20)11(2)12-5-3-4-6-14(12)18-16;/h3-6,8H,9H2,1-2H3;/q-1; |
| InChIKey | GYMRONWXJIUJOP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|