C24H19FN3O2S+ — CID 58758524
1-(benzenesulfonyl)-5-(2-fluorophenyl)-3-(1-methyl-3H-pyrrol-1-ium-4-yl)pyrrolo[2,3-b]pyridine (PubChem CID 58758524) has the molecular formula C24H19FN3O2S+ and a molecular weight of 432.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(2-fluorophenyl)-3-(1-methyl-3H-pyrrol-1-ium-4-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-5-(2-fluorophenyl)-3-(1-methyl-3H-pyrrol-1-ium-4-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 58758524 |
| Molecular Formula | C24H19FN3O2S+ |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(2-fluorophenyl)-3-(1-methyl-3H-pyrrol-1-ium-4-yl)pyrrolo[2,3-b]pyridine |
| SMILES | C[N+]1=CCC(c2cn(S(=O)(=O)c3ccccc3)c3ncc(-c4ccccc4F)cc23)=C1 |
| InChI | InChI=1S/C24H19FN3O2S/c1-27-12-11-17(15-27)22-16-28(31(29,30)19-7-3-2-4-8-19)24-21(22)13-18(14-26-24)20-9-5-6-10-23(20)25/h2-10,12-16H,11H2,1H3/q+1 |
| InChIKey | QYXIVHHLRFGFDO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|