C29H28N6O3S — CID 58760599
1-[3-tert-butyl-1-[4-(phenylsulfamoyl)phenyl]pyrazol-5-yl]-3-quinolin-2-ylurea (PubChem CID 58760599) has the molecular formula C29H28N6O3S and a molecular weight of 540.65 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-[4-(phenylsulfamoyl)phenyl]pyrazol-5-yl]-3-quinolin-2-ylurea.
| Compound Name | 1-[3-tert-butyl-1-[4-(phenylsulfamoyl)phenyl]pyrazol-5-yl]-3-quinolin-2-ylurea |
|---|---|
| PubChem CID | 58760599 |
| Molecular Formula | C29H28N6O3S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-[3-tert-butyl-1-[4-(phenylsulfamoyl)phenyl]pyrazol-5-yl]-3-quinolin-2-ylurea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc3ccccc3n2)n(-c2ccc(S(=O)(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C29H28N6O3S/c1-29(2,3)25-19-27(32-28(36)31-26-18-13-20-9-7-8-12-24(20)30-26)35(33-25)22-14-16-23(17-15-22)39(37,38)34-21-10-5-4-6-11-21/h4-19,34H,1-3H3,(H2,30,31,32,36) |
| InChIKey | AWAAFUJDAMGAHH-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |