About 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile
4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile (PubChem CID 58761300) has the molecular formula C24H17NO4
and a molecular weight of 383.40 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile.
Molecular Properties
| Compound Name | 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile |
| PubChem CID | 58761300 |
| Molecular Formula | C24H17NO4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile |
| SMILES | N#CC(=C=Cc1cc2ccccc2o1)OOCCC=Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C24H17NO4/c25-17-22(13-12-21-16-19-8-2-4-11-24(19)28-21)29-26-14-6-5-9-20-15-18-7-1-3-10-23(18)27-20/h1-5,7-12,15-16H,6,14H2 |
| InChIKey | KPOKTSMBYVAPDJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 68.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile?
The IUPAC name of 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile (CID 58761300) is 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile.
What is the SMILES notation for 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile?
The canonical SMILES for 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile is N#CC(=C=Cc1cc2ccccc2o1)OOCCC=Cc1cc2ccccc2o1.
What is the InChIKey of 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile?
The InChIKey is KPOKTSMBYVAPDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H17NO4/c25-17-22(13-12-21-16-19-8-2-4-11-24(19)28-21)29-26-14-6-5-9-20-15-18-7-1-3-10-23(18)27-20/h1-5,7-12,15-16H,6,14H2.
What are the key properties of 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile?
4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile has a molecular weight of 383.40 g/mol, XLogP of 6.25, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzofuran-2-yl)-2-[4-(1-benzofuran-2-yl)but-3-enylperoxy]buta-2,3-dienenitrile is sourced from PubChem (CID 58761300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).