About 2-ethenyl-1-benzofuran
2-ethenyl-1-benzofuran (PubChem CID 588974) has the molecular formula C10H8O
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-ethenyl-1-benzofuran.
Molecular Properties
| Compound Name | 2-ethenyl-1-benzofuran |
| PubChem CID | 588974 |
| Molecular Formula | C10H8O |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 2-ethenyl-1-benzofuran |
| SMILES | C=Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C10H8O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h2-7H,1H2 |
| InChIKey | HVFZVIHIJNLIED-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1-benzofuran?
The IUPAC name of 2-ethenyl-1-benzofuran (CID 588974) is 2-ethenyl-1-benzofuran.
What is the SMILES notation for 2-ethenyl-1-benzofuran?
The canonical SMILES for 2-ethenyl-1-benzofuran is C=Cc1cc2ccccc2o1.
What is the InChIKey of 2-ethenyl-1-benzofuran?
The InChIKey is HVFZVIHIJNLIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h2-7H,1H2.
What are the key properties of 2-ethenyl-1-benzofuran?
2-ethenyl-1-benzofuran has a molecular weight of 144.17 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1-benzofuran is sourced from PubChem (CID 588974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).