C16H27N3O — CID 172921772
N-[(E)-1-benzofuran-2-ylmethylideneamino]-N-methylmethanamine;N,N-dimethylmethanamine;ethane (PubChem CID 172921772) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is N-[(E)-1-benzofuran-2-ylmethylideneamino]-N-methylmethanamine;N,N-dimethylmethanamine;ethane.
| Compound Name | N-[(E)-1-benzofuran-2-ylmethylideneamino]-N-methylmethanamine;N,N-dimethylmethanamine;ethane |
|---|---|
| PubChem CID | 172921772 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-[(E)-1-benzofuran-2-ylmethylideneamino]-N-methylmethanamine;N,N-dimethylmethanamine;ethane |
| SMILES | CC.CN(C)/N=C/c1cc2ccccc2o1.CN(C)C |
| InChI | InChI=1S/C11H12N2O.C3H9N.C2H6/c1-13(2)12-8-10-7-9-5-3-4-6-11(9)14-10;1-4(2)3;1-2/h3-8H,1-2H3;1-3H3;1-2H3/b12-8+;; |
| InChIKey | SIKWIRUUAXAKHI-BPWZRWDXSA-N |
| XLogP | 3.53 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|