C19H20O — CID 156745259
ethane;10-methyl-9-oxatricyclo[11.4.0.03,8]heptadeca-1,3,5,7,10,12,14,16-octaene (PubChem CID 156745259) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is ethane;10-methyl-9-oxatricyclo[11.4.0.03,8]heptadeca-1,3,5,7,10,12,14,16-octaene.
| Compound Name | ethane;10-methyl-9-oxatricyclo[11.4.0.03,8]heptadeca-1,3,5,7,10,12,14,16-octaene |
|---|---|
| PubChem CID | 156745259 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | ethane;10-methyl-9-oxatricyclo[11.4.0.03,8]heptadeca-1,3,5,7,10,12,14,16-octaene |
| SMILES | CC.Cc1ccc2ccccc2cc2ccccc2o1 |
| InChI | InChI=1S/C17H14O.C2H6/c1-13-10-11-14-6-2-3-7-15(14)12-16-8-4-5-9-17(16)18-13;1-2/h2-12H,1H3;1-2H3/b13-10-,14-11-,15-12-; |
| InChIKey | UEBVSYCSLFELMW-FYNGWTJOSA-N |
| XLogP | 6.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |