About (E)-but-2-ene;ethane;2-methyl-1-benzofuran
(E)-but-2-ene;ethane;2-methyl-1-benzofuran (PubChem CID 143997020) has the molecular formula C17H28O
and a molecular weight of 248.41 g/mol. Its IUPAC name is (E)-but-2-ene;ethane;2-methyl-1-benzofuran.
Molecular Properties
| Compound Name | (E)-but-2-ene;ethane;2-methyl-1-benzofuran |
| PubChem CID | 143997020 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (E)-but-2-ene;ethane;2-methyl-1-benzofuran |
| SMILES | C/C=C/C.CC.CC.Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C9H8O.C4H8.2C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;1-3-4-2;2*1-2/h2-6H,1H3;3-4H,1-2H3;2*1-2H3/b;4-3+;; |
| InChIKey | RHYXEKXKRXOCKA-NXZCPFRHSA-N |
| XLogP | 6.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-ene;ethane;2-methyl-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-ene;ethane;2-methyl-1-benzofuran?
The IUPAC name of (E)-but-2-ene;ethane;2-methyl-1-benzofuran (CID 143997020) is (E)-but-2-ene;ethane;2-methyl-1-benzofuran.
What is the SMILES notation for (E)-but-2-ene;ethane;2-methyl-1-benzofuran?
The canonical SMILES for (E)-but-2-ene;ethane;2-methyl-1-benzofuran is C/C=C/C.CC.CC.Cc1cc2ccccc2o1.
What is the InChIKey of (E)-but-2-ene;ethane;2-methyl-1-benzofuran?
The InChIKey is RHYXEKXKRXOCKA-NXZCPFRHSA-N. The full InChI is InChI=1S/C9H8O.C4H8.2C2H6/c1-7-6-8-4-2-3-5-9(8)10-7;1-3-4-2;2*1-2/h2-6H,1H3;3-4H,1-2H3;2*1-2H3/b;4-3+;;.
What are the key properties of (E)-but-2-ene;ethane;2-methyl-1-benzofuran?
(E)-but-2-ene;ethane;2-methyl-1-benzofuran has a molecular weight of 248.41 g/mol, XLogP of 6.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-ene;ethane;2-methyl-1-benzofuran is sourced from PubChem (CID 143997020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).