About 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol
2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol (PubChem CID 174796863) has the molecular formula C18H16O3
and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol.
Molecular Properties
| Compound Name | 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol |
| PubChem CID | 174796863 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol |
| SMILES | Cc1c(O)oc2ccccc12.Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C9H8O2.C9H8O/c1-6-7-4-2-3-5-8(7)11-9(6)10;1-7-6-8-4-2-3-5-9(8)10-7/h2-5,10H,1H3;2-6H,1H3 |
| InChIKey | LCDZMSFGNUQSPQ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol?
The IUPAC name of 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol (CID 174796863) is 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol.
What is the SMILES notation for 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol?
The canonical SMILES for 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol is Cc1c(O)oc2ccccc12.Cc1cc2ccccc2o1.
What is the InChIKey of 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol?
The InChIKey is LCDZMSFGNUQSPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2.C9H8O/c1-6-7-4-2-3-5-8(7)11-9(6)10;1-7-6-8-4-2-3-5-9(8)10-7/h2-5,10H,1H3;2-6H,1H3.
What are the key properties of 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol?
2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol has a molecular weight of 280.32 g/mol, XLogP of 5.19, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-benzofuran;3-methyl-1-benzofuran-2-ol is sourced from PubChem (CID 174796863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).