C13H15NO2S — CID 155662884
(NE,R)-N-(1-benzofuran-2-ylmethylidene)-2-methylpropane-2-sulfinamide (PubChem CID 155662884) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is (NE,R)-N-(1-benzofuran-2-ylmethylidene)-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-(1-benzofuran-2-ylmethylidene)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 155662884 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (NE,R)-N-(1-benzofuran-2-ylmethylidene)-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H15NO2S/c1-13(2,3)17(15)14-9-11-8-10-6-4-5-7-12(10)16-11/h4-9H,1-3H3/b14-9+/t17-/m1/s1 |
| InChIKey | RZFBMVGRJIZQNX-RKCSUWQLSA-N |
| XLogP | 3.31 |
| TPSA | 42.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|