C21H42OSi2 — CID 58761602
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-[3-(2-trimethylsilyloxyethyl)cyclopentyl]silane (PubChem CID 58761602) has the molecular formula C21H42OSi2 and a molecular weight of 366.74 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-[3-(2-trimethylsilyloxyethyl)cyclopentyl]silane.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-[3-(2-trimethylsilyloxyethyl)cyclopentyl]silane |
|---|---|
| PubChem CID | 58761602 |
| Molecular Formula | C21H42OSi2 |
| Molecular Weight | 366.74 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-[3-(2-trimethylsilyloxyethyl)cyclopentyl]silane |
| SMILES | C[Si](C)(C)OCCC1CCC([Si](C)(C)C2CCC3CCCCC32)C1 |
| InChI | InChI=1S/C21H42OSi2/c1-23(2,3)22-15-14-17-10-12-19(16-17)24(4,5)21-13-11-18-8-6-7-9-20(18)21/h17-21H,6-16H2,1-5H3 |
| InChIKey | WAJQCNOHHNXTDS-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.74 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|