C26H30ClN5O3 — CID 58761846
7-chloro-2-N-[4-[3-(dimethylamino)propoxy]phenyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide (PubChem CID 58761846) has the molecular formula C26H30ClN5O3 and a molecular weight of 496.01 g/mol. Its IUPAC name is 7-chloro-2-N-[4-[3-(dimethylamino)propoxy]phenyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide.
| Compound Name | 7-chloro-2-N-[4-[3-(dimethylamino)propoxy]phenyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
|---|---|
| PubChem CID | 58761846 |
| Molecular Formula | C26H30ClN5O3 |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 7-chloro-2-N-[4-[3-(dimethylamino)propoxy]phenyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-2,8-dicarboxamide |
| SMILES | CN(C)CCCOc1ccc(NC(=O)N2CCn3c(c(C(N)=O)c(Cl)c3-c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H30ClN5O3/c1-30(2)13-6-16-35-20-11-9-19(10-12-20)29-26(34)31-14-15-32-21(17-31)22(25(28)33)23(27)24(32)18-7-4-3-5-8-18/h3-5,7-12H,6,13-17H2,1-2H3,(H2,28,33)(H,29,34) |
| InChIKey | QFOWEUCNKCWPHX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|