C22H21ClN4O2S — CID 58988112
7-chloro-2-[(4-methoxyphenyl)carbamothioyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide (PubChem CID 58988112) has the molecular formula C22H21ClN4O2S and a molecular weight of 440.96 g/mol. Its IUPAC name is 7-chloro-2-[(4-methoxyphenyl)carbamothioyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide.
| Compound Name | 7-chloro-2-[(4-methoxyphenyl)carbamothioyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 58988112 |
| Molecular Formula | C22H21ClN4O2S |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 7-chloro-2-[(4-methoxyphenyl)carbamothioyl]-6-phenyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine-8-carboxamide |
| SMILES | COc1ccc(NC(=S)N2CCn3c(c(C(N)=O)c(Cl)c3-c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H21ClN4O2S/c1-29-16-9-7-15(8-10-16)25-22(30)26-11-12-27-17(13-26)18(21(24)28)19(23)20(27)14-5-3-2-4-6-14/h2-10H,11-13H2,1H3,(H2,24,28)(H,25,30) |
| InChIKey | ZCXUVGMKGPHHHD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|