C17H17NO2S — CID 58762574
S-pyridin-2-yl 2-[(1R)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethanethioate (PubChem CID 58762574) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is S-pyridin-2-yl 2-[(1R)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethanethioate.
| Compound Name | S-pyridin-2-yl 2-[(1R)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethanethioate |
|---|---|
| PubChem CID | 58762574 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | S-pyridin-2-yl 2-[(1R)-6-methoxy-2,3-dihydro-1H-inden-1-yl]ethanethioate |
| SMILES | COc1ccc2c(c1)[C@@H](CC(=O)Sc1ccccn1)CC2 |
| InChI | InChI=1S/C17H17NO2S/c1-20-14-8-7-12-5-6-13(15(12)11-14)10-17(19)21-16-4-2-3-9-18-16/h2-4,7-9,11,13H,5-6,10H2,1H3/t13-/m1/s1 |
| InChIKey | BNUFXFKSGVCOKJ-CYBMUJFWSA-N |
| XLogP | 3.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|